C11H14O3S — CID 7102407
(3R)-3-(4-methylphenoxy)thiolane 1,1-dioxide (PubChem CID 7102407) has the molecular formula C11H14O3S and a molecular weight of 226.30 g/mol. Its IUPAC name is (3R)-3-(4-methylphenoxy)thiolane 1,1-dioxide.
| Compound Name | (3R)-3-(4-methylphenoxy)thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 7102407 |
| Molecular Formula | C11H14O3S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | (3R)-3-(4-methylphenoxy)thiolane 1,1-dioxide |
| SMILES | Cc1ccc(O[C@@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C11H14O3S/c1-9-2-4-10(5-3-9)14-11-6-7-15(12,13)8-11/h2-5,11H,6-8H2,1H3/t11-/m1/s1 |
| InChIKey | FECFVOFOBNGYJW-LLVKDONJSA-N |
| XLogP | 1.56 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |