C11H11NO3S — CID 61058416
4-(1,1-dioxothiolan-3-yl)oxybenzonitrile (PubChem CID 61058416) has the molecular formula C11H11NO3S and a molecular weight of 237.28 g/mol. Its IUPAC name is 4-(1,1-dioxothiolan-3-yl)oxybenzonitrile.
| Compound Name | 4-(1,1-dioxothiolan-3-yl)oxybenzonitrile |
|---|---|
| PubChem CID | 61058416 |
| Molecular Formula | C11H11NO3S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | 4-(1,1-dioxothiolan-3-yl)oxybenzonitrile |
| SMILES | N#Cc1ccc(OC2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C11H11NO3S/c12-7-9-1-3-10(4-2-9)15-11-5-6-16(13,14)8-11/h1-4,11H,5-6,8H2 |
| InChIKey | FAQVPKKSBIPPNM-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |