C12H12N2O3S — CID 7123830
4-cyano-N-[(3R)-1,1-dioxothiolan-3-yl]benzamide (PubChem CID 7123830) has the molecular formula C12H12N2O3S and a molecular weight of 264.31 g/mol. Its IUPAC name is 4-cyano-N-[(3R)-1,1-dioxothiolan-3-yl]benzamide.
| Compound Name | 4-cyano-N-[(3R)-1,1-dioxothiolan-3-yl]benzamide |
|---|---|
| PubChem CID | 7123830 |
| Molecular Formula | C12H12N2O3S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 4-cyano-N-[(3R)-1,1-dioxothiolan-3-yl]benzamide |
| SMILES | N#Cc1ccc(C(=O)N[C@@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C12H12N2O3S/c13-7-9-1-3-10(4-2-9)12(15)14-11-5-6-18(16,17)8-11/h1-4,11H,5-6,8H2,(H,14,15)/t11-/m1/s1 |
| InChIKey | CYANQCVVWUFQFE-LLVKDONJSA-N |
| XLogP | 0.48 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |