C14H15NO4S — CID 60815579
N-(1,1-dioxothiolan-3-yl)-4-(3-hydroxyprop-1-ynyl)benzamide (PubChem CID 60815579) has the molecular formula C14H15NO4S and a molecular weight of 293.34 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-4-(3-hydroxyprop-1-ynyl)benzamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-4-(3-hydroxyprop-1-ynyl)benzamide |
|---|---|
| PubChem CID | 60815579 |
| Molecular Formula | C14H15NO4S |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-4-(3-hydroxyprop-1-ynyl)benzamide |
| SMILES | O=C(NC1CCS(=O)(=O)C1)c1ccc(C#CCO)cc1 |
| InChI | InChI=1S/C14H15NO4S/c16-8-1-2-11-3-5-12(6-4-11)14(17)15-13-7-9-20(18,19)10-13/h3-6,13,16H,7-10H2,(H,15,17) |
| InChIKey | PYULJAQXSXSCJC-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|