C18H16N4O4S — CID 109088380
4-N-(4-cyanophenyl)-2-N-(1,1-dioxothiolan-3-yl)pyridine-2,4-dicarboxamide (PubChem CID 109088380) has the molecular formula C18H16N4O4S and a molecular weight of 384.42 g/mol. Its IUPAC name is 4-N-(4-cyanophenyl)-2-N-(1,1-dioxothiolan-3-yl)pyridine-2,4-dicarboxamide.
| Compound Name | 4-N-(4-cyanophenyl)-2-N-(1,1-dioxothiolan-3-yl)pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109088380 |
| Molecular Formula | C18H16N4O4S |
| Molecular Weight | 384.42 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 4-N-(4-cyanophenyl)-2-N-(1,1-dioxothiolan-3-yl)pyridine-2,4-dicarboxamide |
| SMILES | N#Cc1ccc(NC(=O)c2ccnc(C(=O)NC3CCS(=O)(=O)C3)c2)cc1 |
| InChI | InChI=1S/C18H16N4O4S/c19-10-12-1-3-14(4-2-12)21-17(23)13-5-7-20-16(9-13)18(24)22-15-6-8-27(25,26)11-15/h1-5,7,9,15H,6,8,11H2,(H,21,23)(H,22,24) |
| InChIKey | JFUWLEYOPKQMIJ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 129.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.42 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |