C12H15BrO3S — CID 107723638
3-(4-bromo-3,5-dimethylphenoxy)thiolane 1,1-dioxide (PubChem CID 107723638) has the molecular formula C12H15BrO3S and a molecular weight of 319.22 g/mol. Its IUPAC name is 3-(4-bromo-3,5-dimethylphenoxy)thiolane 1,1-dioxide.
| Compound Name | 3-(4-bromo-3,5-dimethylphenoxy)thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 107723638 |
| Molecular Formula | C12H15BrO3S |
| Molecular Weight | 319.22 g/mol |
| Exact Mass | 317.99 |
| IUPAC Name | 3-(4-bromo-3,5-dimethylphenoxy)thiolane 1,1-dioxide |
| SMILES | Cc1cc(OC2CCS(=O)(=O)C2)cc(C)c1Br |
| InChI | InChI=1S/C12H15BrO3S/c1-8-5-11(6-9(2)12(8)13)16-10-3-4-17(14,15)7-10/h5-6,10H,3-4,7H2,1-2H3 |
| InChIKey | YLELARXJULURAT-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.22 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |