C12H14BrClO — CID 107727208
2-bromo-5-(3-chlorocyclobutyl)oxy-1,3-dimethylbenzene (PubChem CID 107727208) has the molecular formula C12H14BrClO and a molecular weight of 289.60 g/mol. Its IUPAC name is 2-bromo-5-(3-chlorocyclobutyl)oxy-1,3-dimethylbenzene.
| Compound Name | 2-bromo-5-(3-chlorocyclobutyl)oxy-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 107727208 |
| Molecular Formula | C12H14BrClO |
| Molecular Weight | 289.60 g/mol |
| Exact Mass | 287.99 |
| IUPAC Name | 2-bromo-5-(3-chlorocyclobutyl)oxy-1,3-dimethylbenzene |
| SMILES | Cc1cc(OC2CC(Cl)C2)cc(C)c1Br |
| InChI | InChI=1S/C12H14BrClO/c1-7-3-10(4-8(2)12(7)13)15-11-5-9(14)6-11/h3-4,9,11H,5-6H2,1-2H3 |
| InChIKey | FKBWFCAPZAQSIH-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.60 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|