C13H17BrO3S — CID 118086779
2-bromo-1,3-dimethyl-5-(3-methylsulfonylcyclobutyl)oxybenzene (PubChem CID 118086779) has the molecular formula C13H17BrO3S and a molecular weight of 333.25 g/mol. Its IUPAC name is 2-bromo-1,3-dimethyl-5-(3-methylsulfonylcyclobutyl)oxybenzene.
| Compound Name | 2-bromo-1,3-dimethyl-5-(3-methylsulfonylcyclobutyl)oxybenzene |
|---|---|
| PubChem CID | 118086779 |
| Molecular Formula | C13H17BrO3S |
| Molecular Weight | 333.25 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | 2-bromo-1,3-dimethyl-5-(3-methylsulfonylcyclobutyl)oxybenzene |
| SMILES | Cc1cc(OC2CC(S(C)(=O)=O)C2)cc(C)c1Br |
| InChI | InChI=1S/C13H17BrO3S/c1-8-4-10(5-9(2)13(8)14)17-11-6-12(7-11)18(3,15)16/h4-5,11-12H,6-7H2,1-3H3 |
| InChIKey | OQFADTRIBYODHA-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.25 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |