C12H16BrNO3S — CID 86697164
4-(4-bromo-3,5-dimethylphenoxy)thiazinane 1,1-dioxide (PubChem CID 86697164) has the molecular formula C12H16BrNO3S and a molecular weight of 334.24 g/mol. Its IUPAC name is 4-(4-bromo-3,5-dimethylphenoxy)thiazinane 1,1-dioxide.
| Compound Name | 4-(4-bromo-3,5-dimethylphenoxy)thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 86697164 |
| Molecular Formula | C12H16BrNO3S |
| Molecular Weight | 334.24 g/mol |
| Exact Mass | 333.00 |
| IUPAC Name | 4-(4-bromo-3,5-dimethylphenoxy)thiazinane 1,1-dioxide |
| SMILES | Cc1cc(OC2CCS(=O)(=O)NC2)cc(C)c1Br |
| InChI | InChI=1S/C12H16BrNO3S/c1-8-5-11(6-9(2)12(8)13)17-10-3-4-18(15,16)14-7-10/h5-6,10,14H,3-4,7H2,1-2H3 |
| InChIKey | OYAAGQXSESBIQP-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.24 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |