C16H23BrO4 — CID 159598588
(3R)-3-(4-bromo-3,5-dimethylphenoxy)oxolane;(3S)-oxolan-3-ol (PubChem CID 159598588) has the molecular formula C16H23BrO4 and a molecular weight of 359.26 g/mol. Its IUPAC name is (3R)-3-(4-bromo-3,5-dimethylphenoxy)oxolane;(3S)-oxolan-3-ol.
| Compound Name | (3R)-3-(4-bromo-3,5-dimethylphenoxy)oxolane;(3S)-oxolan-3-ol |
|---|---|
| PubChem CID | 159598588 |
| Molecular Formula | C16H23BrO4 |
| Molecular Weight | 359.26 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | (3R)-3-(4-bromo-3,5-dimethylphenoxy)oxolane;(3S)-oxolan-3-ol |
| SMILES | Cc1cc(O[C@@H]2CCOC2)cc(C)c1Br.O[C@H]1CCOC1 |
| InChI | InChI=1S/C12H15BrO2.C4H8O2/c1-8-5-11(6-9(2)12(8)13)15-10-3-4-14-7-10;5-4-1-2-6-3-4/h5-6,10H,3-4,7H2,1-2H3;4-5H,1-3H2/t10-;4-/m10/s1 |
| InChIKey | MLEAMAZXWMWECV-UZHABNROSA-N |
| XLogP | 3.00 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.26 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |