C15H21BrO — CID 107723724
(4-bromo-3,5-dimethylphenoxy)cycloheptane (PubChem CID 107723724) has the molecular formula C15H21BrO and a molecular weight of 297.24 g/mol. Its IUPAC name is (4-bromo-3,5-dimethylphenoxy)cycloheptane.
| Compound Name | (4-bromo-3,5-dimethylphenoxy)cycloheptane |
|---|---|
| PubChem CID | 107723724 |
| Molecular Formula | C15H21BrO |
| Molecular Weight | 297.24 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | (4-bromo-3,5-dimethylphenoxy)cycloheptane |
| SMILES | Cc1cc(OC2CCCCCC2)cc(C)c1Br |
| InChI | InChI=1S/C15H21BrO/c1-11-9-14(10-12(2)15(11)16)17-13-7-5-3-4-6-8-13/h9-10,13H,3-8H2,1-2H3 |
| InChIKey | RTVDQZAEEPCXGM-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.24 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |