C13H19NO3S — CID 55246862
(1R)-1-[2-(1,1-dioxothiolan-3-yl)oxy-4-methylphenyl]ethanamine (PubChem CID 55246862) has the molecular formula C13H19NO3S and a molecular weight of 269.37 g/mol. Its IUPAC name is (1R)-1-[2-(1,1-dioxothiolan-3-yl)oxy-4-methylphenyl]ethanamine.
| Compound Name | (1R)-1-[2-(1,1-dioxothiolan-3-yl)oxy-4-methylphenyl]ethanamine |
|---|---|
| PubChem CID | 55246862 |
| Molecular Formula | C13H19NO3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | (1R)-1-[2-(1,1-dioxothiolan-3-yl)oxy-4-methylphenyl]ethanamine |
| SMILES | Cc1ccc([C@@H](C)N)c(OC2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C13H19NO3S/c1-9-3-4-12(10(2)14)13(7-9)17-11-5-6-18(15,16)8-11/h3-4,7,10-11H,5-6,8,14H2,1-2H3/t10-,11?/m1/s1 |
| InChIKey | VNLPACURJUKILR-NFJWQWPMSA-N |
| XLogP | 1.58 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |