C14H15ClO3S — CID 54914742
3-[2-(3-chloroprop-1-ynyl)-4-methylphenoxy]thiolane 1,1-dioxide (PubChem CID 54914742) has the molecular formula C14H15ClO3S and a molecular weight of 298.79 g/mol. Its IUPAC name is 3-[2-(3-chloroprop-1-ynyl)-4-methylphenoxy]thiolane 1,1-dioxide.
| Compound Name | 3-[2-(3-chloroprop-1-ynyl)-4-methylphenoxy]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 54914742 |
| Molecular Formula | C14H15ClO3S |
| Molecular Weight | 298.79 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 3-[2-(3-chloroprop-1-ynyl)-4-methylphenoxy]thiolane 1,1-dioxide |
| SMILES | Cc1ccc(OC2CCS(=O)(=O)C2)c(C#CCCl)c1 |
| InChI | InChI=1S/C14H15ClO3S/c1-11-4-5-14(12(9-11)3-2-7-15)18-13-6-8-19(16,17)10-13/h4-5,9,13H,6-8,10H2,1H3 |
| InChIKey | JLPFREMDNXRZOS-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.79 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|