C19H25ClO — CID 64739060
2-(4-chlorobut-1-ynyl)-1-(3,4-dimethylcyclohexyl)oxy-4-methylbenzene (PubChem CID 64739060) has the molecular formula C19H25ClO and a molecular weight of 304.86 g/mol. Its IUPAC name is 2-(4-chlorobut-1-ynyl)-1-(3,4-dimethylcyclohexyl)oxy-4-methylbenzene.
| Compound Name | 2-(4-chlorobut-1-ynyl)-1-(3,4-dimethylcyclohexyl)oxy-4-methylbenzene |
|---|---|
| PubChem CID | 64739060 |
| Molecular Formula | C19H25ClO |
| Molecular Weight | 304.86 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 2-(4-chlorobut-1-ynyl)-1-(3,4-dimethylcyclohexyl)oxy-4-methylbenzene |
| SMILES | Cc1ccc(OC2CCC(C)C(C)C2)c(C#CCCCl)c1 |
| InChI | InChI=1S/C19H25ClO/c1-14-7-10-19(17(12-14)6-4-5-11-20)21-18-9-8-15(2)16(3)13-18/h7,10,12,15-16,18H,5,8-9,11,13H2,1-3H3 |
| InChIKey | CLDIUQSZDWZURE-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.86 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|