C19H31ClO2 — CID 6455213
1-[2-(2-chloroethoxy)ethoxy]-2-methyl-4-(2,4,4-trimethylpentan-2-yl)benzene (PubChem CID 6455213) has the molecular formula C19H31ClO2 and a molecular weight of 326.91 g/mol. Its IUPAC name is 1-[2-(2-chloroethoxy)ethoxy]-2-methyl-4-(2,4,4-trimethylpentan-2-yl)benzene.
| Compound Name | 1-[2-(2-chloroethoxy)ethoxy]-2-methyl-4-(2,4,4-trimethylpentan-2-yl)benzene |
|---|---|
| PubChem CID | 6455213 |
| Molecular Formula | C19H31ClO2 |
| Molecular Weight | 326.91 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | 1-[2-(2-chloroethoxy)ethoxy]-2-methyl-4-(2,4,4-trimethylpentan-2-yl)benzene |
| SMILES | Cc1cc(C(C)(C)CC(C)(C)C)ccc1OCCOCCCl |
| InChI | InChI=1S/C19H31ClO2/c1-15-13-16(19(5,6)14-18(2,3)4)7-8-17(15)22-12-11-21-10-9-20/h7-8,13H,9-12,14H2,1-6H3 |
| InChIKey | ANJNNGCPSIRLMC-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.91 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|