C15H26ClNO — CID 170890397
1-(3,5-dimethyl-4-propoxyphenyl)butan-2-amine;hydrochloride (PubChem CID 170890397) has the molecular formula C15H26ClNO and a molecular weight of 271.83 g/mol. Its IUPAC name is 1-(3,5-dimethyl-4-propoxyphenyl)butan-2-amine;hydrochloride.
| Compound Name | 1-(3,5-dimethyl-4-propoxyphenyl)butan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 170890397 |
| Molecular Formula | C15H26ClNO |
| Molecular Weight | 271.83 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 1-(3,5-dimethyl-4-propoxyphenyl)butan-2-amine;hydrochloride |
| SMILES | CCCOc1c(C)cc(CC(N)CC)cc1C.Cl |
| InChI | InChI=1S/C15H25NO.ClH/c1-5-7-17-15-11(3)8-13(9-12(15)4)10-14(16)6-2;/h8-9,14H,5-7,10,16H2,1-4H3;1H |
| InChIKey | LSZSLUFABFEPHU-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.83 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |