C16H24N2O — CID 54930345
4-[4-(2-aminobutyl)-2,6-dimethylphenoxy]butanenitrile (PubChem CID 54930345) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is 4-[4-(2-aminobutyl)-2,6-dimethylphenoxy]butanenitrile.
| Compound Name | 4-[4-(2-aminobutyl)-2,6-dimethylphenoxy]butanenitrile |
|---|---|
| PubChem CID | 54930345 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 4-[4-(2-aminobutyl)-2,6-dimethylphenoxy]butanenitrile |
| SMILES | CCC(N)Cc1cc(C)c(OCCCC#N)c(C)c1 |
| InChI | InChI=1S/C16H24N2O/c1-4-15(18)11-14-9-12(2)16(13(3)10-14)19-8-6-5-7-17/h9-10,15H,4-6,8,11,18H2,1-3H3 |
| InChIKey | FLLYCKGUYCJSOW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|