C17H25Br2NO — CID 107739935
1-(3,5-dibromo-4-cycloheptyloxyphenyl)butan-2-amine (PubChem CID 107739935) has the molecular formula C17H25Br2NO and a molecular weight of 419.20 g/mol. Its IUPAC name is 1-(3,5-dibromo-4-cycloheptyloxyphenyl)butan-2-amine.
| Compound Name | 1-(3,5-dibromo-4-cycloheptyloxyphenyl)butan-2-amine |
|---|---|
| PubChem CID | 107739935 |
| Molecular Formula | C17H25Br2NO |
| Molecular Weight | 419.20 g/mol |
| Exact Mass | 417.03 |
| IUPAC Name | 1-(3,5-dibromo-4-cycloheptyloxyphenyl)butan-2-amine |
| SMILES | CCC(N)Cc1cc(Br)c(OC2CCCCCC2)c(Br)c1 |
| InChI | InChI=1S/C17H25Br2NO/c1-2-13(20)9-12-10-15(18)17(16(19)11-12)21-14-7-5-3-4-6-8-14/h10-11,13-14H,2-9,20H2,1H3 |
| InChIKey | ZTMIEJNOBONQQQ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.20 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |