C15H19Br2NO — CID 107743553
N-[(3,5-dibromo-4-cyclopentyloxyphenyl)methyl]cyclopropanamine (PubChem CID 107743553) has the molecular formula C15H19Br2NO and a molecular weight of 389.13 g/mol. Its IUPAC name is N-[(3,5-dibromo-4-cyclopentyloxyphenyl)methyl]cyclopropanamine.
| Compound Name | N-[(3,5-dibromo-4-cyclopentyloxyphenyl)methyl]cyclopropanamine |
|---|---|
| PubChem CID | 107743553 |
| Molecular Formula | C15H19Br2NO |
| Molecular Weight | 389.13 g/mol |
| Exact Mass | 386.98 |
| IUPAC Name | N-[(3,5-dibromo-4-cyclopentyloxyphenyl)methyl]cyclopropanamine |
| SMILES | Brc1cc(CNC2CC2)cc(Br)c1OC1CCCC1 |
| InChI | InChI=1S/C15H19Br2NO/c16-13-7-10(9-18-11-5-6-11)8-14(17)15(13)19-12-3-1-2-4-12/h7-8,11-12,18H,1-6,9H2 |
| InChIKey | IPOBBVJSNMLAOC-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.13 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |