C16H23Br2NO — CID 107742316
N-[(3,5-dibromo-4-cyclohexyloxyphenyl)methyl]propan-1-amine (PubChem CID 107742316) has the molecular formula C16H23Br2NO and a molecular weight of 405.17 g/mol. Its IUPAC name is N-[(3,5-dibromo-4-cyclohexyloxyphenyl)methyl]propan-1-amine.
| Compound Name | N-[(3,5-dibromo-4-cyclohexyloxyphenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 107742316 |
| Molecular Formula | C16H23Br2NO |
| Molecular Weight | 405.17 g/mol |
| Exact Mass | 403.01 |
| IUPAC Name | N-[(3,5-dibromo-4-cyclohexyloxyphenyl)methyl]propan-1-amine |
| SMILES | CCCNCc1cc(Br)c(OC2CCCCC2)c(Br)c1 |
| InChI | InChI=1S/C16H23Br2NO/c1-2-8-19-11-12-9-14(17)16(15(18)10-12)20-13-6-4-3-5-7-13/h9-10,13,19H,2-8,11H2,1H3 |
| InChIKey | IBUZHVRROYOPFE-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.17 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|