C11H13Br2F2NO — CID 107739943
1-[3,5-dibromo-4-(difluoromethoxy)phenyl]butan-2-amine (PubChem CID 107739943) has the molecular formula C11H13Br2F2NO and a molecular weight of 373.04 g/mol. Its IUPAC name is 1-[3,5-dibromo-4-(difluoromethoxy)phenyl]butan-2-amine.
| Compound Name | 1-[3,5-dibromo-4-(difluoromethoxy)phenyl]butan-2-amine |
|---|---|
| PubChem CID | 107739943 |
| Molecular Formula | C11H13Br2F2NO |
| Molecular Weight | 373.04 g/mol |
| Exact Mass | 370.93 |
| IUPAC Name | 1-[3,5-dibromo-4-(difluoromethoxy)phenyl]butan-2-amine |
| SMILES | CCC(N)Cc1cc(Br)c(OC(F)F)c(Br)c1 |
| InChI | InChI=1S/C11H13Br2F2NO/c1-2-7(16)3-6-4-8(12)10(9(13)5-6)17-11(14)15/h4-5,7,11H,2-3,16H2,1H3 |
| InChIKey | DOXYAROERXAOHJ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.04 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |