C9H5Br2F2NO — CID 121227967
2-[3,5-dibromo-4-(difluoromethoxy)phenyl]acetonitrile (PubChem CID 121227967) has the molecular formula C9H5Br2F2NO and a molecular weight of 340.95 g/mol. Its IUPAC name is 2-[3,5-dibromo-4-(difluoromethoxy)phenyl]acetonitrile.
| Compound Name | 2-[3,5-dibromo-4-(difluoromethoxy)phenyl]acetonitrile |
|---|---|
| PubChem CID | 121227967 |
| Molecular Formula | C9H5Br2F2NO |
| Molecular Weight | 340.95 g/mol |
| Exact Mass | 338.87 |
| IUPAC Name | 2-[3,5-dibromo-4-(difluoromethoxy)phenyl]acetonitrile |
| SMILES | N#CCc1cc(Br)c(OC(F)F)c(Br)c1 |
| InChI | InChI=1S/C9H5Br2F2NO/c10-6-3-5(1-2-14)4-7(11)8(6)15-9(12)13/h3-4,9H,1H2 |
| InChIKey | FETZNEHHXQGBMP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.95 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |