C9H4Br2N2 — CID 171007952
2,3-dibromo-5-(cyanomethyl)benzonitrile (PubChem CID 171007952) has the molecular formula C9H4Br2N2 and a molecular weight of 299.95 g/mol. Its IUPAC name is 2,3-dibromo-5-(cyanomethyl)benzonitrile.
| Compound Name | 2,3-dibromo-5-(cyanomethyl)benzonitrile |
|---|---|
| PubChem CID | 171007952 |
| Molecular Formula | C9H4Br2N2 |
| Molecular Weight | 299.95 g/mol |
| Exact Mass | 297.87 |
| IUPAC Name | 2,3-dibromo-5-(cyanomethyl)benzonitrile |
| SMILES | N#CCc1cc(Br)c(Br)c(C#N)c1 |
| InChI | InChI=1S/C9H4Br2N2/c10-8-4-6(1-2-12)3-7(5-13)9(8)11/h3-4H,1H2 |
| InChIKey | ZEPMJQRBMZMUDN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.95 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |