C15H21Br2NO3 — CID 107739980
2-[4-(2-aminobutyl)-2,6-dibromophenoxy]pentanoic acid (PubChem CID 107739980) has the molecular formula C15H21Br2NO3 and a molecular weight of 423.15 g/mol. Its IUPAC name is 2-[4-(2-aminobutyl)-2,6-dibromophenoxy]pentanoic acid.
| Compound Name | 2-[4-(2-aminobutyl)-2,6-dibromophenoxy]pentanoic acid |
|---|---|
| PubChem CID | 107739980 |
| Molecular Formula | C15H21Br2NO3 |
| Molecular Weight | 423.15 g/mol |
| Exact Mass | 420.99 |
| IUPAC Name | 2-[4-(2-aminobutyl)-2,6-dibromophenoxy]pentanoic acid |
| SMILES | CCCC(Oc1c(Br)cc(CC(N)CC)cc1Br)C(=O)O |
| InChI | InChI=1S/C15H21Br2NO3/c1-3-5-13(15(19)20)21-14-11(16)7-9(8-12(14)17)6-10(18)4-2/h7-8,10,13H,3-6,18H2,1-2H3,(H,19,20) |
| InChIKey | GXEUQCWPMBLCQB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.15 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |