C12H14Br2O4 — CID 107739093
2-[2,6-dibromo-4-(hydroxymethyl)phenoxy]pentanoic acid (PubChem CID 107739093) has the molecular formula C12H14Br2O4 and a molecular weight of 382.05 g/mol. Its IUPAC name is 2-[2,6-dibromo-4-(hydroxymethyl)phenoxy]pentanoic acid.
| Compound Name | 2-[2,6-dibromo-4-(hydroxymethyl)phenoxy]pentanoic acid |
|---|---|
| PubChem CID | 107739093 |
| Molecular Formula | C12H14Br2O4 |
| Molecular Weight | 382.05 g/mol |
| Exact Mass | 379.93 |
| IUPAC Name | 2-[2,6-dibromo-4-(hydroxymethyl)phenoxy]pentanoic acid |
| SMILES | CCCC(Oc1c(Br)cc(CO)cc1Br)C(=O)O |
| InChI | InChI=1S/C12H14Br2O4/c1-2-3-10(12(16)17)18-11-8(13)4-7(6-15)5-9(11)14/h4-5,10,15H,2-3,6H2,1H3,(H,16,17) |
| InChIKey | ZIUNJKZZMQHYCY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.05 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |