C13H18BrNO4 — CID 64667110
2-[4-(aminomethyl)-2-bromo-6-ethoxyphenoxy]butanoic acid (PubChem CID 64667110) has the molecular formula C13H18BrNO4 and a molecular weight of 332.19 g/mol. Its IUPAC name is 2-[4-(aminomethyl)-2-bromo-6-ethoxyphenoxy]butanoic acid.
| Compound Name | 2-[4-(aminomethyl)-2-bromo-6-ethoxyphenoxy]butanoic acid |
|---|---|
| PubChem CID | 64667110 |
| Molecular Formula | C13H18BrNO4 |
| Molecular Weight | 332.19 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | 2-[4-(aminomethyl)-2-bromo-6-ethoxyphenoxy]butanoic acid |
| SMILES | CCOc1cc(CN)cc(Br)c1OC(CC)C(=O)O |
| InChI | InChI=1S/C13H18BrNO4/c1-3-10(13(16)17)19-12-9(14)5-8(7-15)6-11(12)18-4-2/h5-6,10H,3-4,7,15H2,1-2H3,(H,16,17) |
| InChIKey | GFBIMGGPDSRHIZ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.19 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |