C15H21BrN2O3 — CID 61488931
2-[4-(aminomethyl)-2-bromo-6-ethoxyphenoxy]-N-cyclopropyl-N-methylacetamide (PubChem CID 61488931) has the molecular formula C15H21BrN2O3 and a molecular weight of 357.25 g/mol. Its IUPAC name is 2-[4-(aminomethyl)-2-bromo-6-ethoxyphenoxy]-N-cyclopropyl-N-methylacetamide.
| Compound Name | 2-[4-(aminomethyl)-2-bromo-6-ethoxyphenoxy]-N-cyclopropyl-N-methylacetamide |
|---|---|
| PubChem CID | 61488931 |
| Molecular Formula | C15H21BrN2O3 |
| Molecular Weight | 357.25 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | 2-[4-(aminomethyl)-2-bromo-6-ethoxyphenoxy]-N-cyclopropyl-N-methylacetamide |
| SMILES | CCOc1cc(CN)cc(Br)c1OCC(=O)N(C)C1CC1 |
| InChI | InChI=1S/C15H21BrN2O3/c1-3-20-13-7-10(8-17)6-12(16)15(13)21-9-14(19)18(2)11-4-5-11/h6-7,11H,3-5,8-9,17H2,1-2H3 |
| InChIKey | WFOJFTWAHCQODF-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.25 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |