C15H23NO3 — CID 83048971
2-[4-(2-aminoethyl)-2,6-dimethylphenoxy]pentanoic acid (PubChem CID 83048971) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is 2-[4-(2-aminoethyl)-2,6-dimethylphenoxy]pentanoic acid.
| Compound Name | 2-[4-(2-aminoethyl)-2,6-dimethylphenoxy]pentanoic acid |
|---|---|
| PubChem CID | 83048971 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 2-[4-(2-aminoethyl)-2,6-dimethylphenoxy]pentanoic acid |
| SMILES | CCCC(Oc1c(C)cc(CCN)cc1C)C(=O)O |
| InChI | InChI=1S/C15H23NO3/c1-4-5-13(15(17)18)19-14-10(2)8-12(6-7-16)9-11(14)3/h8-9,13H,4-7,16H2,1-3H3,(H,17,18) |
| InChIKey | MGMLNBYLXKUSLG-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |