C13H17BrO4 — CID 63936239
[3-bromo-5-methoxy-4-(oxan-4-yloxy)phenyl]methanol (PubChem CID 63936239) has the molecular formula C13H17BrO4 and a molecular weight of 317.18 g/mol. Its IUPAC name is [3-bromo-5-methoxy-4-(oxan-4-yloxy)phenyl]methanol.
| Compound Name | [3-bromo-5-methoxy-4-(oxan-4-yloxy)phenyl]methanol |
|---|---|
| PubChem CID | 63936239 |
| Molecular Formula | C13H17BrO4 |
| Molecular Weight | 317.18 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | [3-bromo-5-methoxy-4-(oxan-4-yloxy)phenyl]methanol |
| SMILES | COc1cc(CO)cc(Br)c1OC1CCOCC1 |
| InChI | InChI=1S/C13H17BrO4/c1-16-12-7-9(8-15)6-11(14)13(12)18-10-2-4-17-5-3-10/h6-7,10,15H,2-5,8H2,1H3 |
| InChIKey | HXRFYQISCHBELC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.18 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |