C16H22Br2O2 — CID 64738583
1-bromo-5-(bromomethyl)-2-(3,4-dimethylcyclohexyl)oxy-3-methoxybenzene (PubChem CID 64738583) has the molecular formula C16H22Br2O2 and a molecular weight of 406.16 g/mol. Its IUPAC name is 1-bromo-5-(bromomethyl)-2-(3,4-dimethylcyclohexyl)oxy-3-methoxybenzene.
| Compound Name | 1-bromo-5-(bromomethyl)-2-(3,4-dimethylcyclohexyl)oxy-3-methoxybenzene |
|---|---|
| PubChem CID | 64738583 |
| Molecular Formula | C16H22Br2O2 |
| Molecular Weight | 406.16 g/mol |
| Exact Mass | 404.00 |
| IUPAC Name | 1-bromo-5-(bromomethyl)-2-(3,4-dimethylcyclohexyl)oxy-3-methoxybenzene |
| SMILES | COc1cc(CBr)cc(Br)c1OC1CCC(C)C(C)C1 |
| InChI | InChI=1S/C16H22Br2O2/c1-10-4-5-13(6-11(10)2)20-16-14(18)7-12(9-17)8-15(16)19-3/h7-8,10-11,13H,4-6,9H2,1-3H3 |
| InChIKey | DLVZCSCKBROBNZ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.16 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|