C14H19ClO — CID 65460366
5-(chloromethyl)-2-(cyclobutylmethoxy)-1,3-dimethylbenzene (PubChem CID 65460366) has the molecular formula C14H19ClO and a molecular weight of 238.76 g/mol. Its IUPAC name is 5-(chloromethyl)-2-(cyclobutylmethoxy)-1,3-dimethylbenzene.
| Compound Name | 5-(chloromethyl)-2-(cyclobutylmethoxy)-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 65460366 |
| Molecular Formula | C14H19ClO |
| Molecular Weight | 238.76 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 5-(chloromethyl)-2-(cyclobutylmethoxy)-1,3-dimethylbenzene |
| SMILES | Cc1cc(CCl)cc(C)c1OCC1CCC1 |
| InChI | InChI=1S/C14H19ClO/c1-10-6-13(8-15)7-11(2)14(10)16-9-12-4-3-5-12/h6-7,12H,3-5,8-9H2,1-2H3 |
| InChIKey | QJGWGMDSGVZYAR-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.76 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|