C15H21Cl2NO — CID 54793716
[3,5-dichloro-2-(2-cyclohexylethoxy)phenyl]methanamine (PubChem CID 54793716) has the molecular formula C15H21Cl2NO and a molecular weight of 302.24 g/mol. Its IUPAC name is [3,5-dichloro-2-(2-cyclohexylethoxy)phenyl]methanamine.
| Compound Name | [3,5-dichloro-2-(2-cyclohexylethoxy)phenyl]methanamine |
|---|---|
| PubChem CID | 54793716 |
| Molecular Formula | C15H21Cl2NO |
| Molecular Weight | 302.24 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | [3,5-dichloro-2-(2-cyclohexylethoxy)phenyl]methanamine |
| SMILES | NCc1cc(Cl)cc(Cl)c1OCCC1CCCCC1 |
| InChI | InChI=1S/C15H21Cl2NO/c16-13-8-12(10-18)15(14(17)9-13)19-7-6-11-4-2-1-3-5-11/h8-9,11H,1-7,10,18H2 |
| InChIKey | HMYFQVAHPPCVCF-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.24 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |