C11H11Cl2NO3 — CID 60887506
3-[2-(aminomethyl)-4,6-dichlorophenoxy]oxolan-2-one (PubChem CID 60887506) has the molecular formula C11H11Cl2NO3 and a molecular weight of 276.12 g/mol. Its IUPAC name is 3-[2-(aminomethyl)-4,6-dichlorophenoxy]oxolan-2-one.
| Compound Name | 3-[2-(aminomethyl)-4,6-dichlorophenoxy]oxolan-2-one |
|---|---|
| PubChem CID | 60887506 |
| Molecular Formula | C11H11Cl2NO3 |
| Molecular Weight | 276.12 g/mol |
| Exact Mass | 275.01 |
| IUPAC Name | 3-[2-(aminomethyl)-4,6-dichlorophenoxy]oxolan-2-one |
| SMILES | NCc1cc(Cl)cc(Cl)c1OC1CCOC1=O |
| InChI | InChI=1S/C11H11Cl2NO3/c12-7-3-6(5-14)10(8(13)4-7)17-9-1-2-16-11(9)15/h3-4,9H,1-2,5,14H2 |
| InChIKey | XDDZULHLWIGRBA-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.12 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |