C15H14Br2N2O4 — CID 126051403
5-[[3,5-dibromo-4-(2-methylpropoxy)phenyl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 126051403) has the molecular formula C15H14Br2N2O4 and a molecular weight of 446.10 g/mol. Its IUPAC name is 5-[[3,5-dibromo-4-(2-methylpropoxy)phenyl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[[3,5-dibromo-4-(2-methylpropoxy)phenyl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126051403 |
| Molecular Formula | C15H14Br2N2O4 |
| Molecular Weight | 446.10 g/mol |
| Exact Mass | 443.93 |
| IUPAC Name | 5-[[3,5-dibromo-4-(2-methylpropoxy)phenyl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | CC(C)COc1c(Br)cc(C=C2C(=O)NC(=O)NC2=O)cc1Br |
| InChI | InChI=1S/C15H14Br2N2O4/c1-7(2)6-23-12-10(16)4-8(5-11(12)17)3-9-13(20)18-15(22)19-14(9)21/h3-5,7H,6H2,1-2H3,(H2,18,19,20,21,22) |
| InChIKey | WWXGSYLWMMEYPJ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.10 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|