C11H14Br2O2S — CID 107738867
[3,5-dibromo-4-(3-methylsulfanylpropoxy)phenyl]methanol (PubChem CID 107738867) has the molecular formula C11H14Br2O2S and a molecular weight of 370.11 g/mol. Its IUPAC name is [3,5-dibromo-4-(3-methylsulfanylpropoxy)phenyl]methanol.
| Compound Name | [3,5-dibromo-4-(3-methylsulfanylpropoxy)phenyl]methanol |
|---|---|
| PubChem CID | 107738867 |
| Molecular Formula | C11H14Br2O2S |
| Molecular Weight | 370.11 g/mol |
| Exact Mass | 367.91 |
| IUPAC Name | [3,5-dibromo-4-(3-methylsulfanylpropoxy)phenyl]methanol |
| SMILES | CSCCCOc1c(Br)cc(CO)cc1Br |
| InChI | InChI=1S/C11H14Br2O2S/c1-16-4-2-3-15-11-9(12)5-8(7-14)6-10(11)13/h5-6,14H,2-4,7H2,1H3 |
| InChIKey | CAAUWMYQHGAAIC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.11 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|