C14H19Br2NO2 — CID 107738824
[3,5-dibromo-4-(2-piperidin-1-ylethoxy)phenyl]methanol (PubChem CID 107738824) has the molecular formula C14H19Br2NO2 and a molecular weight of 393.12 g/mol. Its IUPAC name is [3,5-dibromo-4-(2-piperidin-1-ylethoxy)phenyl]methanol.
| Compound Name | [3,5-dibromo-4-(2-piperidin-1-ylethoxy)phenyl]methanol |
|---|---|
| PubChem CID | 107738824 |
| Molecular Formula | C14H19Br2NO2 |
| Molecular Weight | 393.12 g/mol |
| Exact Mass | 390.98 |
| IUPAC Name | [3,5-dibromo-4-(2-piperidin-1-ylethoxy)phenyl]methanol |
| SMILES | OCc1cc(Br)c(OCCN2CCCCC2)c(Br)c1 |
| InChI | InChI=1S/C14H19Br2NO2/c15-12-8-11(10-18)9-13(16)14(12)19-7-6-17-4-2-1-3-5-17/h8-9,18H,1-7,10H2 |
| InChIKey | NVTYJGFYMMFVFL-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.12 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |