C15H22Br2N2O — CID 107739417
2-[3,5-dibromo-4-(3-pyrrolidin-1-ylpropoxy)phenyl]ethanamine (PubChem CID 107739417) has the molecular formula C15H22Br2N2O and a molecular weight of 406.16 g/mol. Its IUPAC name is 2-[3,5-dibromo-4-(3-pyrrolidin-1-ylpropoxy)phenyl]ethanamine.
| Compound Name | 2-[3,5-dibromo-4-(3-pyrrolidin-1-ylpropoxy)phenyl]ethanamine |
|---|---|
| PubChem CID | 107739417 |
| Molecular Formula | C15H22Br2N2O |
| Molecular Weight | 406.16 g/mol |
| Exact Mass | 404.01 |
| IUPAC Name | 2-[3,5-dibromo-4-(3-pyrrolidin-1-ylpropoxy)phenyl]ethanamine |
| SMILES | NCCc1cc(Br)c(OCCCN2CCCC2)c(Br)c1 |
| InChI | InChI=1S/C15H22Br2N2O/c16-13-10-12(4-5-18)11-14(17)15(13)20-9-3-8-19-6-1-2-7-19/h10-11H,1-9,18H2 |
| InChIKey | DISXGDYWINZGMN-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.16 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|