C13H16Cl3NO — CID 5336537
1-[2-(2,4,6-trichlorophenoxy)ethyl]piperidine (PubChem CID 5336537) has the molecular formula C13H16Cl3NO and a molecular weight of 308.64 g/mol. Its IUPAC name is 1-[2-(2,4,6-trichlorophenoxy)ethyl]piperidine.
| Compound Name | 1-[2-(2,4,6-trichlorophenoxy)ethyl]piperidine |
|---|---|
| PubChem CID | 5336537 |
| Molecular Formula | C13H16Cl3NO |
| Molecular Weight | 308.64 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | 1-[2-(2,4,6-trichlorophenoxy)ethyl]piperidine |
| SMILES | Clc1cc(Cl)c(OCCN2CCCCC2)c(Cl)c1 |
| InChI | InChI=1S/C13H16Cl3NO/c14-10-8-11(15)13(12(16)9-10)18-7-6-17-4-2-1-3-5-17/h8-9H,1-7H2 |
| InChIKey | ATCCNTNFJLQDCY-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.64 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |