C12H16Br2O4S — CID 107738877
[3,5-dibromo-4-(2-propan-2-ylsulfonylethoxy)phenyl]methanol (PubChem CID 107738877) has the molecular formula C12H16Br2O4S and a molecular weight of 416.13 g/mol. Its IUPAC name is [3,5-dibromo-4-(2-propan-2-ylsulfonylethoxy)phenyl]methanol.
| Compound Name | [3,5-dibromo-4-(2-propan-2-ylsulfonylethoxy)phenyl]methanol |
|---|---|
| PubChem CID | 107738877 |
| Molecular Formula | C12H16Br2O4S |
| Molecular Weight | 416.13 g/mol |
| Exact Mass | 413.91 |
| IUPAC Name | [3,5-dibromo-4-(2-propan-2-ylsulfonylethoxy)phenyl]methanol |
| SMILES | CC(C)S(=O)(=O)CCOc1c(Br)cc(CO)cc1Br |
| InChI | InChI=1S/C12H16Br2O4S/c1-8(2)19(16,17)4-3-18-12-10(13)5-9(7-15)6-11(12)14/h5-6,8,15H,3-4,7H2,1-2H3 |
| InChIKey | LHCUZPOMWSMHJQ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.13 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |