C12H14Cl2O4S — CID 106725141
3,5-dichloro-2-(2-propan-2-ylsulfonylethoxy)benzaldehyde (PubChem CID 106725141) has the molecular formula C12H14Cl2O4S and a molecular weight of 325.21 g/mol. Its IUPAC name is 3,5-dichloro-2-(2-propan-2-ylsulfonylethoxy)benzaldehyde.
| Compound Name | 3,5-dichloro-2-(2-propan-2-ylsulfonylethoxy)benzaldehyde |
|---|---|
| PubChem CID | 106725141 |
| Molecular Formula | C12H14Cl2O4S |
| Molecular Weight | 325.21 g/mol |
| Exact Mass | 324.00 |
| IUPAC Name | 3,5-dichloro-2-(2-propan-2-ylsulfonylethoxy)benzaldehyde |
| SMILES | CC(C)S(=O)(=O)CCOc1c(Cl)cc(Cl)cc1C=O |
| InChI | InChI=1S/C12H14Cl2O4S/c1-8(2)19(16,17)4-3-18-12-9(7-15)5-10(13)6-11(12)14/h5-8H,3-4H2,1-2H3 |
| InChIKey | ZTUXHGMAODESIB-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.21 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|