C14H21BrO4 — CID 112590025
[3-bromo-5-methoxy-4-[2-[(2-methylpropan-2-yl)oxy]ethoxy]phenyl]methanol (PubChem CID 112590025) has the molecular formula C14H21BrO4 and a molecular weight of 333.22 g/mol. Its IUPAC name is [3-bromo-5-methoxy-4-[2-[(2-methylpropan-2-yl)oxy]ethoxy]phenyl]methanol.
| Compound Name | [3-bromo-5-methoxy-4-[2-[(2-methylpropan-2-yl)oxy]ethoxy]phenyl]methanol |
|---|---|
| PubChem CID | 112590025 |
| Molecular Formula | C14H21BrO4 |
| Molecular Weight | 333.22 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | [3-bromo-5-methoxy-4-[2-[(2-methylpropan-2-yl)oxy]ethoxy]phenyl]methanol |
| SMILES | COc1cc(CO)cc(Br)c1OCCOC(C)(C)C |
| InChI | InChI=1S/C14H21BrO4/c1-14(2,3)19-6-5-18-13-11(15)7-10(9-16)8-12(13)17-4/h7-8,16H,5-6,9H2,1-4H3 |
| InChIKey | XRPOUOCKEUZODS-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.22 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|