C17H16Br2O2 — CID 107738328
3,5-dibromo-4-[(4-propan-2-ylphenyl)methoxy]benzaldehyde (PubChem CID 107738328) has the molecular formula C17H16Br2O2 and a molecular weight of 412.12 g/mol. Its IUPAC name is 3,5-dibromo-4-[(4-propan-2-ylphenyl)methoxy]benzaldehyde.
| Compound Name | 3,5-dibromo-4-[(4-propan-2-ylphenyl)methoxy]benzaldehyde |
|---|---|
| PubChem CID | 107738328 |
| Molecular Formula | C17H16Br2O2 |
| Molecular Weight | 412.12 g/mol |
| Exact Mass | 409.95 |
| IUPAC Name | 3,5-dibromo-4-[(4-propan-2-ylphenyl)methoxy]benzaldehyde |
| SMILES | CC(C)c1ccc(COc2c(Br)cc(C=O)cc2Br)cc1 |
| InChI | InChI=1S/C17H16Br2O2/c1-11(2)14-5-3-12(4-6-14)10-21-17-15(18)7-13(9-20)8-16(17)19/h3-9,11H,10H2,1-2H3 |
| InChIKey | JCPACNAYNMXODO-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.12 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|