C14H8Br2F2O2 — CID 107738201
3,5-dibromo-4-[(2,6-difluorophenyl)methoxy]benzaldehyde (PubChem CID 107738201) has the molecular formula C14H8Br2F2O2 and a molecular weight of 406.02 g/mol. Its IUPAC name is 3,5-dibromo-4-[(2,6-difluorophenyl)methoxy]benzaldehyde.
| Compound Name | 3,5-dibromo-4-[(2,6-difluorophenyl)methoxy]benzaldehyde |
|---|---|
| PubChem CID | 107738201 |
| Molecular Formula | C14H8Br2F2O2 |
| Molecular Weight | 406.02 g/mol |
| Exact Mass | 403.89 |
| IUPAC Name | 3,5-dibromo-4-[(2,6-difluorophenyl)methoxy]benzaldehyde |
| SMILES | O=Cc1cc(Br)c(OCc2c(F)cccc2F)c(Br)c1 |
| InChI | InChI=1S/C14H8Br2F2O2/c15-10-4-8(6-19)5-11(16)14(10)20-7-9-12(17)2-1-3-13(9)18/h1-6H,7H2 |
| InChIKey | NWDKUZFBSXMEEG-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.02 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|