C15H11BrClFO3 — CID 66529281
6-bromo-2-[(2-chloro-6-fluorophenyl)methoxy]-3-methoxybenzaldehyde (PubChem CID 66529281) has the molecular formula C15H11BrClFO3 and a molecular weight of 373.61 g/mol. Its IUPAC name is 6-bromo-2-[(2-chloro-6-fluorophenyl)methoxy]-3-methoxybenzaldehyde.
| Compound Name | 6-bromo-2-[(2-chloro-6-fluorophenyl)methoxy]-3-methoxybenzaldehyde |
|---|---|
| PubChem CID | 66529281 |
| Molecular Formula | C15H11BrClFO3 |
| Molecular Weight | 373.61 g/mol |
| Exact Mass | 371.96 |
| IUPAC Name | 6-bromo-2-[(2-chloro-6-fluorophenyl)methoxy]-3-methoxybenzaldehyde |
| SMILES | COc1ccc(Br)c(C=O)c1OCc1c(F)cccc1Cl |
| InChI | InChI=1S/C15H11BrClFO3/c1-20-14-6-5-11(16)9(7-19)15(14)21-8-10-12(17)3-2-4-13(10)18/h2-7H,8H2,1H3 |
| InChIKey | LVJOKAHRSINTHC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.61 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|