C17H18ClFN2O2 — CID 110340270
N-[(E)-[2-[(2-chloro-6-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-N-methylmethanamine (PubChem CID 110340270) has the molecular formula C17H18ClFN2O2 and a molecular weight of 336.79 g/mol. Its IUPAC name is N-[(E)-[2-[(2-chloro-6-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-N-methylmethanamine.
| Compound Name | N-[(E)-[2-[(2-chloro-6-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-N-methylmethanamine |
|---|---|
| PubChem CID | 110340270 |
| Molecular Formula | C17H18ClFN2O2 |
| Molecular Weight | 336.79 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | N-[(E)-[2-[(2-chloro-6-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-N-methylmethanamine |
| SMILES | COc1cccc(/C=N/N(C)C)c1OCc1c(F)cccc1Cl |
| InChI | InChI=1S/C17H18ClFN2O2/c1-21(2)20-10-12-6-4-9-16(22-3)17(12)23-11-13-14(18)7-5-8-15(13)19/h4-10H,11H2,1-3H3/b20-10+ |
| InChIKey | LAHLVYKDALVQEP-KEBDBYFISA-N |
| XLogP | 3.96 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.79 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|