C26H22ClFN2O3 — CID 29039274
(Z)-3-[2-[(2-chloro-6-fluorophenyl)methoxy]-3-methoxyphenyl]-2-cyano-N-[(1S)-1-phenylethyl]prop-2-enamide (PubChem CID 29039274) has the molecular formula C26H22ClFN2O3 and a molecular weight of 464.92 g/mol. Its IUPAC name is (Z)-3-[2-[(2-chloro-6-fluorophenyl)methoxy]-3-methoxyphenyl]-2-cyano-N-[(1S)-1-phenylethyl]prop-2-enamide.
| Compound Name | (Z)-3-[2-[(2-chloro-6-fluorophenyl)methoxy]-3-methoxyphenyl]-2-cyano-N-[(1S)-1-phenylethyl]prop-2-enamide |
|---|---|
| PubChem CID | 29039274 |
| Molecular Formula | C26H22ClFN2O3 |
| Molecular Weight | 464.92 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | (Z)-3-[2-[(2-chloro-6-fluorophenyl)methoxy]-3-methoxyphenyl]-2-cyano-N-[(1S)-1-phenylethyl]prop-2-enamide |
| SMILES | COc1cccc(/C=C(/C#N)C(=O)N[C@@H](C)c2ccccc2)c1OCc1c(F)cccc1Cl |
| InChI | InChI=1S/C26H22ClFN2O3/c1-17(18-8-4-3-5-9-18)30-26(31)20(15-29)14-19-10-6-13-24(32-2)25(19)33-16-21-22(27)11-7-12-23(21)28/h3-14,17H,16H2,1-2H3,(H,30,31)/b20-14-/t17-/m0/s1 |
| InChIKey | SNQOODNORRWWLJ-PNWWAVQQSA-N |
| XLogP | 5.85 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.92 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|