C18H20BrClFNO2 — CID 66537107
N-[[6-bromo-2-[(2-chloro-6-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]propan-2-amine (PubChem CID 66537107) has the molecular formula C18H20BrClFNO2 and a molecular weight of 416.72 g/mol. Its IUPAC name is N-[[6-bromo-2-[(2-chloro-6-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]propan-2-amine.
| Compound Name | N-[[6-bromo-2-[(2-chloro-6-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 66537107 |
| Molecular Formula | C18H20BrClFNO2 |
| Molecular Weight | 416.72 g/mol |
| Exact Mass | 415.03 |
| IUPAC Name | N-[[6-bromo-2-[(2-chloro-6-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]propan-2-amine |
| SMILES | COc1ccc(Br)c(CNC(C)C)c1OCc1c(F)cccc1Cl |
| InChI | InChI=1S/C18H20BrClFNO2/c1-11(2)22-9-12-14(19)7-8-17(23-3)18(12)24-10-13-15(20)5-4-6-16(13)21/h4-8,11,22H,9-10H2,1-3H3 |
| InChIKey | PGEXTAGPJKVSGW-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.72 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |