C19H23BrFNO2 — CID 66536432
N-[[6-bromo-2-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]butan-2-amine (PubChem CID 66536432) has the molecular formula C19H23BrFNO2 and a molecular weight of 396.30 g/mol. Its IUPAC name is N-[[6-bromo-2-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]butan-2-amine.
| Compound Name | N-[[6-bromo-2-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]butan-2-amine |
|---|---|
| PubChem CID | 66536432 |
| Molecular Formula | C19H23BrFNO2 |
| Molecular Weight | 396.30 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | N-[[6-bromo-2-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]butan-2-amine |
| SMILES | CCC(C)NCc1c(Br)ccc(OC)c1OCc1ccccc1F |
| InChI | InChI=1S/C19H23BrFNO2/c1-4-13(2)22-11-15-16(20)9-10-18(23-3)19(15)24-12-14-7-5-6-8-17(14)21/h5-10,13,22H,4,11-12H2,1-3H3 |
| InChIKey | YXXJQAKFWYGVLG-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.30 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |