C16H10Br2O2S — CID 107738165
4-(1-benzothiophen-3-ylmethoxy)-3,5-dibromobenzaldehyde (PubChem CID 107738165) has the molecular formula C16H10Br2O2S and a molecular weight of 426.13 g/mol. Its IUPAC name is 4-(1-benzothiophen-3-ylmethoxy)-3,5-dibromobenzaldehyde.
| Compound Name | 4-(1-benzothiophen-3-ylmethoxy)-3,5-dibromobenzaldehyde |
|---|---|
| PubChem CID | 107738165 |
| Molecular Formula | C16H10Br2O2S |
| Molecular Weight | 426.13 g/mol |
| Exact Mass | 423.88 |
| IUPAC Name | 4-(1-benzothiophen-3-ylmethoxy)-3,5-dibromobenzaldehyde |
| SMILES | O=Cc1cc(Br)c(OCc2csc3ccccc23)c(Br)c1 |
| InChI | InChI=1S/C16H10Br2O2S/c17-13-5-10(7-19)6-14(18)16(13)20-8-11-9-21-15-4-2-1-3-12(11)15/h1-7,9H,8H2 |
| InChIKey | JSXKFQYGEDXFIL-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.13 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|