C14H9Br2ClO2 — CID 4770151
3,5-dibromo-4-[(3-chlorophenyl)methoxy]benzaldehyde (PubChem CID 4770151) has the molecular formula C14H9Br2ClO2 and a molecular weight of 404.49 g/mol. Its IUPAC name is 3,5-dibromo-4-[(3-chlorophenyl)methoxy]benzaldehyde.
| Compound Name | 3,5-dibromo-4-[(3-chlorophenyl)methoxy]benzaldehyde |
|---|---|
| PubChem CID | 4770151 |
| Molecular Formula | C14H9Br2ClO2 |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 401.87 |
| IUPAC Name | 3,5-dibromo-4-[(3-chlorophenyl)methoxy]benzaldehyde |
| SMILES | O=Cc1cc(Br)c(OCc2cccc(Cl)c2)c(Br)c1 |
| InChI | InChI=1S/C14H9Br2ClO2/c15-12-5-10(7-18)6-13(16)14(12)19-8-9-2-1-3-11(17)4-9/h1-7H,8H2 |
| InChIKey | ZAVPDOWHKHLJCH-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|